Diferència entre revisions de la pàgina «Mentol»

932 bytes afegits ,  fa 4 anys
cap resum d'edició
m (Robot inserta {{Autoritat}})
{{ChemboxEn
{{Chembox
| Watchedfields = changed
| Nom = Mentol
| verifiedrevid = 443251484
| Imatge = Menthol_skeletal.svg
| Name = Menthol
| Mida imatge = 200 px
| Imatge ImageFileL1 = Menthol_skeletal.svg
| Peu =
| ImageNameL1 = (−)-Mentol
| Imatge2 =
| ImageFileR1 = Menthol-from-xtal-1999-3D-balls.png
| Mida imatge2 =
| ImageNameR1 = Model de boles i pals of (−)-menthol
| Peu2 =
| ImageFile2 = Menthol.jpg
| IUPAC =
| IUPACName = (1''R'',2''S'',5''R'')-2-Isopropil-5-metilciclohexanol
| Altres noms =
| OtherNames = 3-''p''''-Mentanol<br />Hexahidrotimol<br />Mentomentol<br />Menta càmfora
| Fórmula = C<sub>10</sub>H<sub>20</sub>O
|Section1={{Chembox Identifiers
| Massa molar = 156.27 g mol<sup>-1</sup>
| IUPHAR_ligand = 2430
| Aparença =
| SMILES = O[C@H]1[C@H](C(C)C)CC[C@@H](C)C1
| Densitat =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| Solubilitat =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| Punt de fusió =
| ChEBI = 15409
| Punt d'ebullició =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| pKa =
| DrugBank = DB00825
| pKb =
| ChemSpiderID = 15803
| Perills =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| Frases R =
| ChEMBL = 470670
| Frases S =
| SMILES1 = O[C@H]1[C@H](C(C)C)CC[C@@H](C)C1
| CAS =
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem =
| UNII = YS08XHA860
| MeSHName =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| SMILES =
| StdInChI = 1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1
| Punt d'inflamabilitat =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| Anions =
| StdInChIKey = NOOLISFMXDJSKH-KXUCPTDWSA-N
| Compostos relacionats = [[Pirofosfat de geranil]], [[Limonè]]
| InChI = 1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1
| Cations =
| InChIKey1 = NOOLISFMXDJSKH-KXUCPTDWSA-N
| DrugBank =
| CASNo_Ref = {{cascite|correct|CAS}}
| Ignició espontània =
| CASNo = 89-78-1
| Límit d'explosió =
| RTECS = OT0350000, racemic
<!-- Valors per a NFPA -->
}}
| H =
|Section2={{Chembox Properties
| F =
| R C=10 | H=20 | O= 1
| Appearance = Sòlid cristal·lí blanc o incolor
| O =
| Density = 0,890&thinsp;g·cm<sup>&minus;3</sup>, solid<br /> (racèmic or (&minus;)-isòmer)
| Classificació UE =
| Solubility = Lleugerament soluble, (&minus;)-isòmer
| FDS =
| MeltingPtC = 36 to 38
| Cristall =
| MeltingPt_notes = racèmic<br /> 42–45&nbsp;°C, (&minus;)-isòmer, forma cristal·lina α
| Coordinació =
| BoilingPtC = 212
| RTECS =
}}
| CAS altres =
|Section7={{Chembox Hazards
| ExternalSDS = [[Menthol chemdata supplement#Material Safety Data Sheet|External MSDS]]
| MainHazards = Irritant, inflamable
| FlashPtC = 93
| RPhrases = {{R37/38}}, {{R41}}
| SPhrases = {{S26}}, {{S36}}
}}
|Section8={{Chembox Related
| OtherFunction_label = [[alcohol]]s
| OtherFunction = [[Ciclohexanol]], [[Pulegol]],<br/>[[Dihidrocarveol]], [[Piperitol]]
| OtherCompounds = [[Mentona]], [[Mentè]],<br/>[[Timol]] ''p''-[[Cymene]],<br/>[[Citronel·la]]}}
}}
 
El '''mentol''', en [[anglès]]: ''menthol'', és un [[compost orgànic]] de tipus [[terpè]] -exactament un [[monoterpè]] [[alcohol]]-, una substància aromàtica present en algunes [[plantes]] com per exemple la [[menta]]<ref>{{ref-web|url=http://www.pherobase.com/database/floral-compounds/floral-taxa-compounds-detail-menthol.php|títol=Llista de plantes que contenen mentol|editor=Pherobase}}{{en}}</ref> (d'on prové el nom) tot i que també es pot produir sintèticament. S'[[Evaporació|evapora]] fàcilment absorbint [[calor]], per això és molt [[olor]]osa i dóna sensació de frescor. La seva [[fórmula química]] és C<sub>10</sub>H<sub>20</sub>O.
 
És una substància cerosa i cristal·lina de color clar o blanc sòlid a [[temperatura ambient]] i que es fon lleugerament per sobre d'aquesta temperatura. La principal forma que es troba en la natura és (−)-mentol. El '''mentol''' és un [[anestèsic]] local i amb propietats contra la [[irritació]] emprant-se especialment contra les irritacions menors de la [[Gola (anatomia) |gola]]. També actua com un antagonista del receptor opioide kappa.
 
==Estructura==
46.927

modificacions