Obre el menú principal

Canvis

600 octets eliminats ,  fa 4 anys
cap resum d'edició
{{ChemboxEn
{{Chembox
| verifiedrevid = 444077628
| Nom = Pirofosfat
| ImageFile = Pyrophosphate_anion.png
| Imatge = Pyrophosphate-3D-balls.png
| ImageSize = 150px
| Mida imatge =
| Imatge ImageFile1 = Pyrophosphate-3D-balls.png
| Peu =
| ImageSize1 = 150px
| Imatge2 = Pyrophosphate-3D-vdW.png
| ImageAlt1 =
| Mida imatge2 =
| ImageName1 = Anió pirofosfat
| Peu2 =
| IUPACName =
| IUPAC = {{Amaga text|InChI|1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-4}}<br />
| Altres noms OtherNames = Pirofosfat<br />Àcid fosfònic <br />Ió pirofosfat<br />Pirometafosfat<br />Pirofosfat tetraanió<br />Ió pirofosfat(4-)<ref name="Pub">{{ref-web|url=http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644102|títol=diphosphate - Compound Summary |consulta=01/12/2013 | editor= National Center for Biotechnology Information | llengua=anglès}}</ref>
{{Amaga text|Clau InChI|XPPKVPWEQAFLFU-UHFFFAOYSA-J}}
|Section1={{Chembox Identifiers
| Altres noms = Pirofosfat<br />Àcid fosfònic <br />Ió pirofosfat<br />Pirometafosfat<br />Pirofosfat tetraanió<br />Ió pirofosfat(4-)<ref name="Pub">{{ref-web|url=http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644102|títol=diphosphate - Compound Summary |consulta=01/12/2013 | editor= National Center for Biotechnology Information | llengua=anglès}}</ref>
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| Fórmula = {{Chembox/Chem|O|7|P|2}}<sup>4−</sup> [[Fitxer:Pyrophosphate anion.png|120px|Pirofosfat]]
| ChemSpiderID = 559142
| Massa molar = 173,943324<ref name="Pub"/>
| InChI = 1/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-4
| Aparença =
| InChIKey = XPPKVPWEQAFLFU-XBHQNQODAI
| Densitat =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| Solubilitat =
| IUPAC StdInChI = {{Amaga text|InChI|1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-4}}<br />
| Punt de fusió =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| Punt d'ebullició =
{{Amaga text|Clau InChI|StdInChIKey = XPPKVPWEQAFLFU-UHFFFAOYSA-J}}
| pKa =
| CASNo_Ref = {{cascite|correct|??}}
| pKb =
| CASNo =
| Perills =
| PubChem = 644102
| Frases R =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| Frases S =
| DrugBank = DB04160
| CAS =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| PubChem = 644102
| ChEBI = 18361
| MeSHName =
| SMILES = [O-]P(=O)([O-])OP(=O)([O-])[O-]
| SMILES = <nowiki>[O-]P(=O)([O-])OP(=O)([O-])[O-]</nowiki><ref name="Royal">{{ref-web|url=http://www.chemspider.com/Chemical-Structure.559142.html|títol=Royal Society of Chemistry - diphosphate |consulta=01/12/2013 | editor=Royal Society of Chemistry | llengua=anglès}}</ref>
}}
| Punt d'inflamabilitat =
|Section2={{Chembox Properties
| Anions =
| Formula = P<sub>2</sub>O<sub>7</sub><sup>4−</sup>
| Compostos relacionats =
| MolarMass =
| Cations =
| Appearance =
| DrugBank =
| Density =
| Ignició espontània =
| MeltingPt =
| Límit d'explosió =
| BoilingPt =
<!-- Valors per a NFPA -->
| Solubility = }}
| H =
|Section3={{Chembox Hazards
| F =
| MainHazards =
| R =
| FlashPt =
| O =
| AutoignitionPt = }}
| Classificació UE =
| FDS =
| Cristall =
| Coordinació =
| RTECS =
| CAS altres =
}}
El '''pirofosfat''' és qualsevol [[Sal (química)|sal]], [[anió]] o els [[èster]] que impliquin un o més àtoms d'[[àcid pirofosfòric]].<ref name="Enciclopèdia">{{ref-web|url=http://www.enciclopedia.cat/diccionaris/gran-diccionari-de-la-llengua-catalana/EC-GDLC-e00104525.xml?s.q=pirofosfat#gdlc/EC-GDLC-e00104525.xml|títol=pirofosfat |consulta=01/12/2013 |obra = [[Gran Enciclopèdia Catalana]]| llengua=català}}</ref> Els pirofosfats s'obtenen escalfant fosfats: el prefix “piro-” deriva del grec i significa “foc” en aquest context. Els pirofosfats són bons agents complementaris i tenen molts usos en la indústria química. La paraula pirofosfat és també el nom dels èsters formats per la [[Reacció de condensació|condensació]] de compostos fosforilats biològicament mitjançant un fosfat inorgànic o per un [[pirofosfat de dimetilal·lil]]. Aquesta unió també es refereix a unions altament energètiques dels fosfats.
37.637

modificacions