Trinitrotoluè: diferència entre les revisions
Contingut suprimit Contingut afegit
m Robot substitueix PAGENAME pel nom de la pàgina. |
Cap resum de modificació |
||
Línia 1:
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 458775807
| ImageFileL1 = Trinitrotoluene.svg
| ImageFileR1 = TNT-from-xtal-1982-3D-balls.png
| ImageFile2 = Trinitrotoluen.JPG
| ImageSize2 =
| ImageAlt2 = trinitrotoluè sòlid
| IUPACName = 2-Metil-1,3,5-trinitrobenzè
| OtherNames = 2,4,6-Trinitrotoluè,<br>TNT, Trilita, Trinitrotoluol,<br>2,4,6-Trinitrometilbenzè
|Section1={{Chembox Identifiers
| Abbreviations = TNT
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 8073
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1236345
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = H43RF5TRM5
| InChI1 = 1/C7H5N3O6/c1-4-2-3-5(8(11)12)7(10(15)16)6(4)9(13)14/h2-3H,1H3
| InChIKey1 = FPKOPBFLPLFWAD-UHFFFAOYAR
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 118-96-7
| UNNumber = [[List of UN Numbers 0201 to 0300|0209]] – ''Sec o humit amb <30% d'aigua''<br />[[List of UN Numbers 0301 to 0400|0388, 0389]] – ''Barreges amb trinitrobenzè i hexanitrostilbè''
| EINECS = 204-289-6
| PubChem = 11763
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01676
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C7H5N3O6/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16/h2-3H,1H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = SPSSULHKWOKEEL-UHFFFAOYSA-N
| SMILES = Cc1c(cc(cc1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-]
| InChI = 1/C7H5N3O6/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16/h2-3H,1H3
| RTECS = XU0175000
| MeSHName =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI =
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C16391
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =}}
|Section2={{Chembox Properties
| C=7 | H=5 | N=3 | O=6
| Appearance = Sòlid groc pàl·lid. Agulles, flocs, abans de fusió. Un bloc sòlid després que s'aboca en una capsa.
| Density = 1,654 g/cm<sup>3</sup>
| MeltingPtC = 80,35
| MeltingPt_notes =
| BoilingPtC = 240,0
| BoilingPt_notes = (es descompon)<ref>[http://www.inchem.org/documents/icsc/icsc/eics0967.htm 2,4,6-Trinitrotoluene]. inchem.org</ref>
| Solubility = 0,13 g/L (20 °C)
| SolubleOther = Soluble
| Solvent = [[èter]], [[acetona]], [[benzè]], [[piridina]]
| pKa =
| pKb =
| VaporPressure = 0,0002 mmHg (20°C)<ref name=PGCH/>
}}
|Section6={{Chembox Explosive
| ShockSens = Insensible
| FrictionSens = Insensible a 353 N
| DetonationV = 6900 m/s
| REFactor = 1,00
}}
|Section7={{Chembox Hazards
| ExternalSDS = [http://www.inchem.org/documents/icsc/icsc/eics0967.htm ICSC 0967]
| EUClass = {{Hazchem E}} Explosiu
{{Hazchem T}} Tòxic
{{Hazchem N}} Perillós pel medi ambient
| NFPA-H = 2
| NFPA-F = 4
| NFPA-R = 4
| NFPA-S =
| RPhrases = {{R2}}, {{R23/24/25}}, {{R33}}, {{R51/53}}
| SPhrases = {{S1/2}}, {{S35}}, {{S45}}, {{S61}}
| FlashPtC = 167
| AutoignitionPtC =
| ExploLimits =
| PEL = TWA 1,5 mg/m<sup>3</sup> [pell]<ref name=PGCH/>
| IDLH = 500 mg/m<sup>3</sup><ref name=PGCH>{{PGCH|0641}}</ref>
| REL = TWA 0,5 mg/m<sup>3</sup> [pell]<ref name=PGCH/>
| LD50 = 795 mg/kg (rata, oral)<br/>660 (ratolí, oral)<ref name=IDLH>{{IDLH|118967|2,4,6-Trinitrotoluene}}</ref>
| LDLo = 500 mg/kg (conill, oral)<br/>1850 mg/kg (gat, oral)<ref name=IDLH/>
}}
|Section8={{Chembox Related
| OtherCompounds = [[Àcid pícric]]<br/>[[Hexanitrobenzè]]<br/>[[2,4-Dinitrotoluè]]}}
}}
El '''trinitrotoluè''' ('''TNT''') o 2,4,6-trinitrometilbenzè (notació [[IUPAC]]) és un [[hidrocarbur aromàtic]] [[cristal·lí]] de color groc pàl·lid que es fon a 81 °C.
| |||