Acetat de coure(II): diferència entre les revisions

Contingut suprimit Contingut afegit
Correcció nomenclatura
Infotaula
Línia 1:
{{chembox
[[Fitxer:Crystalline copper acetate.JPG|thumb|300px|Acetat de coure(II)]]
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 451266922
| Name = Copper(II) acetate
| ImageFile1 = Copper(II)-acetate.jpg
| ImageCaption1 = Small crystals of copper(II) acetate
| ImageFile2 = Copper(II)acetate crystal 01.jpg
| ImageCaption2 = Copper(II) acetate crystals on copper wire
| ImageName = Copper(II) acetate hydrate
| IUPACName = Tetra-''μ''<sup>2</sup>-acetatodiaquadicopper(II)
| OtherNames = Copper(II) ethanoate<br>Cupric acetate<br>Copper Acetate<br>Verdigris
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8555
| PubChem = 8895
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 39M11XPH03
| InChI = 1/2C2H4O2.Cu/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2
| InChIKey = OPQARKPSCNTWTJ-NUQVWONBAO
| SMILES = [Cu+2].[O-]C(=O)C.[O-]C(=O)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/2C2H4O2.Cu/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OPQARKPSCNTWTJ-UHFFFAOYSA-L
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 142-71-2
| CASNo_Comment = (anhydrous)
| CASNo2_Ref = {{cascite|changed|??}}
| CASNo2 = 6046-93-1
| CASNo2_Comment = (hydrate)
}}
|Section2={{Chembox Properties
| Formula = Cu(CH<sub>3</sub>COO)<sub>2</sub>
| MolarMass = 181,63 g/mol (anhydrous)<br/>199.65 g/mol (hydrate)
| Appearance = Dark green crystalline solid
| Odor = odorless (hydrate)
| MeltingPt = Undetermined <ref>{{cite journal|doi=10.1021/ed053p397 | volume=53 | title=Copper(II) acetate monohydrate - An erroneous melting point | journal=Journal of Chemical Education | page=397 | last1 = Trimble | first1 = R. F.}}</ref>
| BoilingPtC = 240
| Solubility = ''hydrate:'' <br> 7.2 g/100 mL (cold water) <br> 20 g/100 mL (hot water)
| SolubleOther = Soluble in [[alcohol]]<br>Slightly soluble in [[ether]] and [[glycerol]]
| Density = 1.882 g/cm<sup>3</sup> (hydrate)
| RefractIndex = 1.545 (hydrate)
}}
|Section3={{Chembox Structure
| CrystalStruct = [[Monoclinic]]
}}
|Section7={{Chembox Hazards
| ExternalSDS = [http://www.mallbaker.com/americas/msds/english/C5808_msds_us_Default.pdf Baker MSDS]
| FlashPt = Non-flammable
| LD50 = 710mg/kg oral rat <ref>{{cite web |url=http://www.sargentwelch.com/pdf/msds/Copper_II_Acetate_212.00.pdf |title=Archived copy |accessdate=2011-06-14 |deadurl=yes |archiveurl=https://web.archive.org/web/20110928193709/http://www.sargentwelch.com/pdf/msds/Copper_II_Acetate_212.00.pdf |archivedate=2011-09-28 |df= }}</ref>
| PEL = TWA 1 mg/m<sup>3</sup> (as Cu)<ref name=PGCH>{{PGCH|0150}}</ref>
| REL = TWA 1 mg/m<sup>3</sup> (as Cu)<ref name=PGCH/>
| IDLH = TWA 100 mg/m<sup>3</sup> (as Cu)<ref name=PGCH/>
}}
}}
L''''acetat de coure(II)''', de fórmula Cu(CH<sub>3</sub>COO)<sub>2</sub>, és un compost químic que sol presentar-se en forma monohidratada. És un sòlid cristal·lí de color verd fosc. S'utilitza com a [[oxidant|agent oxidant]] en síntesi orgànica.
 
== Referències ==
{{Referències}}
 
{{Commonscat}}
 
{{ORDENA:Acetat De Coure (II)}} <!--ORDENA generat per bot-->
 
[[Categoria:Compostos de coure]]
[[Categoria:Acetats|Coure]]