Diferència entre revisions de la pàgina «Cerebrosterol»

2.863 octets eliminats ,  fa 3 anys
Robot canvia de Chembox a Infotaula compost químic
m (bot: - descartar varies hipòtesis, + descartar diverses hipòtesis,)
(Robot canvia de Chembox a Infotaula compost químic)
{{Infotaula compost químic}}
{{Chembox
| Name = Cerebrosterol <ref> https://pubchem.ncbi.nlm.nih.gov/compound/Cerebrosterol#section=Top </ref>
| Reference =
| IUPACName =(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5S)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro1Hcyclopenta[a]phenanthren-3-ol
| SystematicName =
| OtherNames = {{Unbulleted list
| ''Cholest-5-ene-3,24-diol''
| ''24S-OHC''
}}
| ImageFile = 24s-ohc.jpg
| ImageSize =
| ImageAlt = 360px
| ImageName =
| ImageSize1 =
| ImageName1 =
| ImageFile2 =
| ImageSize2 =
| ImageName2 =
| ImageFile3 =
| ImageSize3 =
| ImageFileL1 =
| ImageSizeL1 =
| ImageNameL1 =
| ImageFileR1 =
| ImageSizeR1 =
| ImageNameR1 =
| ImageFileL2 =
| ImageSizeL2 =
| ImageNameL2 =
| ImageFileR2 =
| ImageSizeR2 =
|Section1 = {{Chembox Identifiers
| Formula = | C = 26 | H = 46 | O = 2
| 3DMet =
| Abbreviations =
| Beilstein =
| CASNo =
| CASNo_Comment =
| CASOther =
| ChEBI =
| ChemSpiderID =
| EINECS =
| Gmelin =
| InChI = IOWMKBFJCNLRTC-XWXSNNQWSA-N
| KEGG =
| MeSHName =
| PubChem = Cerebrosterol
| RTECS =
| SMILES = C[C@H](CC[C@@H](C(C)C)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C
| UNNumber =
}}
|Section2 = {{Chembox Properties
| Formula = | C = 26 | H = 46 | O = 2
| AtmosphericOHRateConstant =
| Appearance =
| BoilingPt =
| BoilingPtC =
| BoilingPt_ref =
| BoilingPt_notes =
| Density =
| HenryConstant =
| LogP =
| MolarMass = 402.663 g/mol
| MeltingPt =
| MeltingPtC =
| MeltingPt_ref =
| MeltingPt_notes =
| Odor =
| pKa =
| pKb =
| Solubility =
| SolubleOther =
| Solvent =
| VaporPressure =
}}
|Section3 = {{Chembox Structure
| Coordination =
| CrystalStruct =
| MolShape =
}}
|Section4 = {{Chembox Thermochemistry
| DeltaGf =
| DeltaHc =
| DeltaHf =
| Entropy =
| HeatCapacity =
}}
|Section5 = {{Chembox Explosive
| ShockSens =
| FrictionSens =
| DetonationV =
| REFactor =
}}
|Section6 = {{Chembox Pharmacology
| ATCvet =
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =
| AdminRoutes =
| Bioavail =
| Excretion =
| HalfLife =
| Metabolism =
| DrugBank =
| DrugBank_Comment =
| DrugBank1 =
| DrugBank1_Comment =
| legal_status =
| legal_AU =
| legal_AU_comment =
| legal_CA =
| legal_CA_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_US =
| legal_US_comment =
| legal_UK =
| legal_UK_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| pregnancy_category =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_US =
| ProteinBound =
| Dependence_liability =
| Addiction_liability =
}}
|Section7 = {{Chembox Hazards
| AutoignitionPt =
| EUClass =
| ExploLimits =
| ExternalMSDS =
| FlashPt =
| LD50 =
| LC50 =
| MainHazards =
| NFPA-F =
| NFPA-H =
| NFPA-R =
| NFPA-S =
| PEL =
| REL =
| RPhrases =
| SPhrases =
| RSPhrases =
}}
}}
El '''cerebrosterol''' ('''24(S)-hidroxicolesterol''' o '''24S-OHC''') és un oxiesterol d’origen biològic derivat del [[colesterol]] i precursor dels àcids biliars. És l'oxiesterol més abundant al cervell dels mamífers, i encara que només representa entre un 0.1-0.3% en respecte al total de colesterol en aquest òrgan, n’és responsable d’una part important del metabolisme del colesterol al cervell, com a regulador de la seva síntesi i com a mecanisme d'eliminació del colesterol al cervell.<ref name=":1">{{Ref-publicació|cognom=Björkhem|nom=Ingemar|article=Rediscovery of Cerebrosterol|publicació=Lipids|llengua=en|url=https://link.springer.com/article/10.1007/s11745-006-1003-2|volum=42|exemplar=1|data=2007-02-01|pàgines=5–14|doi=10.1007/s11745-006-1003-2|issn=0024-4201}}</ref> Aproximadament el 90% del cerebrosterol te origen al sistema nerviós central, i menys del 10% es sintetitza repartit als pulmons, glàndules adrenals, medul·la òssia, entre d'altres orígens perifèrics.<ref name=":3">{{Ref-publicació|cognom=M.|nom=Hughes, Timothy|cognom2=Caterina|nom2=Rosano,|cognom3=W.|nom3=Evans, Rhobert|cognom4=H.|nom4=Kuller, Lewis|article=Brain Cholesterol Metabolism, Oxysterols, and Dementia|publicació=Journal of Alzheimer's Disease|llengua=en|url=http://www.medra.org/servlet/aliasResolver?alias=iospress&genre=article&issn=1387-2877&volume=33&issue=4&spage=891&doi=10.3233/JAD-2012-121585|volum=33|exemplar=4|data=2013-01-01|doi=10.3233/jad-2012-121585|issn=1387-2877}}</ref> L'excés o deficiència d'aquest oxiesterol pot ser un indicador de malalties neurodegeneratives o demència.<ref name=":0" /> És un lligand [[agonista]] del receptor hepàtic X ('''LXR''', de l'anglès '''''L'''iver '''X''' '''R'''eceptor''). És el segon oxiesterol més abundant al plasma sanguini, precedit pel 27-hidroxicolesterol.<ref>{{Ref-publicació|cognom=Pataj|nom=Zoltán|cognom2=Liebisch|nom2=Gerhard|cognom3=Schmitz|nom3=Gerd|cognom4=Matysik|nom4=Silke|article=Quantification of oxysterols in human plasma and red blood cells by liquid chromatography high-resolution tandem mass spectrometry|publicació=Journal of Chromatography A|url=http://dx.doi.org/10.1016/j.chroma.2015.11.015|volum=1439|pàgines=82–88|doi=10.1016/j.chroma.2015.11.015}}</ref>
 
496.178

modificacions