Diferència entre revisions de la pàgina «Procaïna»

1.618 octets eliminats ,  fa 2 anys
Robot canvia de Drugbox a Infotaula fàrmac
m (Robot treu puntuació penjada després de referències)
(Robot canvia de Drugbox a Infotaula fàrmac)
 
{{Infotaula fàrmac}}
{{Drugbox| Verifiedfields = changed
| verifiedrevid = 420414847
| IUPAC_name = 2-(diethylamino)ethyl 4-aminobenzoate
| image = procaine.svg
| image2 = Procainemodel.png
 
<!--Clinical data-->
| Drugs.com = {{drugs.com|monograph|novocain}}
| pregnancy_AU = B2
| pregnancy_US = C
| legal_AU = S4
| routes_of_administration = [[Parenteral]]
 
<!--Pharmacokinetic data-->
| bioavailability = n/a
| metabolism = [[Hidròlisi]] per les esterases del plasma
| elimination_half-life = 40–84 seconds
| excretion = [[Ronyó]]
 
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 59-46-1
| ATC_prefix = N01
| ATC_suffix = BA02
| ATC_supplemental = {{ATC|C05|AD05}} {{ATC|S01|HA05}}
| PubChem = 4914
| IUPHAR_ligand = 4291
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00721
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4745
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4Z8Y51M438
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08422
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 8430
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 569
| NIAID_ChemDB = 019136
 
<!--Chemical data-->
| C=13 | H=20 | N=2 | O=2
| molecular_weight = 236.31 g/mol
| smiles = O=C(OCCN(CC)CC)c1ccc(N)cc1
| InChI = 1/C13H20N2O2/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H20N2O2/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MFDFERRIHVXMIY-UHFFFAOYSA-N
}}
 
La '''procaïna''' o '''novocaïna''' és un [[anestèsic local]] del grup dels [[aminoèster]]s. Es fa servir principalment per a reduir el dolor de les injeccions intramusculars de [[penicil·lina]] i també l'usen els dentistes. El nom de novocaïna correspon en realitat a una marca registrada, '''Novocain'''. Aquesta droga actua principalment bloquejant la [[canal de sodi]].<ref>[http://www.drugbank.ca/drugs/DB00721 DrugBank - Showing drug card for Procaine (DB00721)] Update Date 2009-06-23</ref> Actualment s'usa terapeuticament en diversos països pels seus efectes simpatolítics, antiinflamatoris de perfusió i sobre l'humor.<ref>J.D. Hahn-Godeffroy: Procain-Reset: Ein Therapiekonzept zur Behandlung chronischer Erkrankungen, Schweiz Z Ganzheitsmed 2011;23:291–296 (DOI:10.1159/000332021)</ref>
414.647

modificacions