Diferència entre revisions de la pàgina «Pentoxifil·lina»

2.165 octets eliminats ,  fa 2 anys
Robot canvia de Drugbox a Infotaula fàrmac
m
(Robot canvia de Drugbox a Infotaula fàrmac)
{{Infotaula fàrmac}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 464198476
| IUPAC_name = 3,7-Dimetil-1-(5-oxohexil)-3,7-dihidro-1''H''-purino-2,6-diona
| image = Pentoxifylline2DACS.svg
| width = 180
| image2 = Pentoxifylline3Dan2.gif
| width2 = 200
 
<!--Clinical data-->
| tradename = Trental
| Drugs.com = {{drugs.com|monograph|pentoxifylline}}
| MedlinePlus = a685027
| licence_US = Pentoxifylline
| pregnancy_AU = B1
| pregnancy_US = C
| pregnancy_category =
| legal_AU = S4
| legal_CA = Rx-only
| legal_UK = POM
| legal_US = Rx-only
| legal_status =
| routes_of_administration = Oral
 
<!--Pharmacokinetic data-->
| bioavailability = 10-30%<ref name = MSR>{{ref-web|títol=Trental, Pentoxil (pentoxifylline) dosing, indications, interactions, adverse effects, and more|obra=Medscape Reference|editor=WebMD|consulta= 3 febrer 2014|url=http://reference.medscape.com/drug/trental-pentoxil-pentoxifylline-342179#showall}}</ref>
| protein_bound =
| metabolism = [[Fetge|Hepàtic]] i via [[hematies|glòbuls rojos]]
| elimination_half-life = 0,4-0,8 hores (1-1,6 hores pels metabòlits actius)<ref name = MSR/>
| excretion = Orina (95%), femta (<4%)<ref name = MSR/>
 
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 6493-05-6
| ATC_prefix = C04
| ATC_suffix = AD03
| PubChem = 4740
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00806
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4578
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = SD6QCT3TSU
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00501
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 628
 
<!--Chemical data-->
| C=13 | H=18 | N=4 | O=3
| molecular_weight = 278.31 g/mol
| smiles = O=C2N(c1ncn(c1C(=O)N2CCCCC(=O)C)C)C
| InChI = 1/C13H18N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8H,4-7H2,1-3H3
| InChIKey = BYPFEZZEUUWMEJ-UHFFFAOYAP
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H18N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8H,4-7H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BYPFEZZEUUWMEJ-UHFFFAOYSA-N
}}
La '''pentoxifil·lina''' és un derivat de la [[xantina]] usat en la mitigació de la [[claudicació]] intermitent en individus amb [[malaltia vascular perifèrica]].
 
393.082

modificacions