Diferència entre revisions de la pàgina «Clorpromazina»

2.797 octets eliminats ,  fa 2 anys
Robot canvia de Drugbox a Infotaula fàrmac
m (Robot: reemplaçament automàtic de text (- mg + mg))
(Robot canvia de Drugbox a Infotaula fàrmac)
{{Infotaula fàrmac}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 443519547
| IUPAC_name = 3-(2-chloro-10''H''-phenothiazin-10-yl)-''N'',''N''-dimethyl-propan-1-amine
| image = Chlorpromazine.svg
| alt = Fórmula esquelètica de la clorpromazina
| width = 222
| image2 = Chlorpromazine molecule ball.png
| alt2 = Model de barres i esferes de la molècula de la clorpromazina
<!--Clinical data-->
| tradename = Largactil, Thorazine, altres
| Drugs.com = {{drugs.com|monograph|chlorpromazine-hydrochloride}}
| licence_US = Chlorpromazine
| MedlinePlus = a682040
| pregnancy_AU = C
| pregnancy_US = C
| legal_AU = S4
| legal_CA = Rx-only
| legal_UK = POM
| legal_US = Rx-only
| routes_of_administration = Orals (pastilles i xarop disponible), [[supositori|rectal]], [[injecció intramuscular|IM]], [[teràpia intravenosa|IV]]
<!--Pharmacokinetic data-->
| bioavailability = 10-80% (Oral; gran variació interindividual)<ref name = TGA>{{cite web|title=PRODUCT INFORMATION LARGACTIL|work=TGA eBusiness Services|publisher=Sanofi Aventis Pty Ltd|date=28 d'agost del 2012|accessdate=8 de desembre del 2013|url=https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-05882-3|format=PDF}}</ref>
| protein_bound = 90-99%<ref name = TGA/>
| metabolism = [[Fetge]], majorment mitjançant [[CYP2D6]]<ref name = TGA/>
| elimination_half-life = 30 hores.<ref name=AHFS2015>{{cite web|title=Chlorpromazine Hydrochloride|url=http://www.drugs.com/monograph/chlorpromazine-hydrochloride.html|publisher=The American Society of Health-System Pharmacists|accessdate= 1 de desembre del 2015}}</ref>
| excretion = Orina (43-65% en 24 hrs)<ref name = TGA/>
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 50-53-3
| CAS_supplemental = (base lliure)<br/>{{CAS|69-09-0}} (clorhidrat)
| ATC_prefix = N05
| ATC_suffix = AA01
| PubChem = 2726
| IUPHAR_ligand = 83
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00477
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2625
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = U42B7VYA4P
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00270
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3647
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 71
<!--Chemical data-->
| C=17 | H=19 | Cl=1 | N=2 | S=1
| molecular_weight = 318.86 g/mol (base lliure)<br/>355.33 g/mol (clorhidrat)
| smiles = CN(C)CCCN1c2ccccc2Sc3c1cc(cc3)Cl
| InChI = 1/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZPEIMTDSQAKGNT-UHFFFAOYSA-N
}}
La '''clorpromazina''' és un [[medicament]] [[neurolèptic]], categoritzat dins dels [[antipsicòtic]]s clàssics o típics. El seu descobriment per a posterior ús en la [[psiquiatria]] s'anomena la "Quarta revolució en Psiquiatria".
 
393.020

modificacions