Viquipèdia

Bupivacaïna: diferència entre les revisions

Exploració interactiva de l'historial
← Edició anteriorEdició següent →
Contingut suprimit Contingut afegit
VisualWikitext
Robot catalanitza noms i paràmetres de plantilles
Robot canvia de Drugbox a Infotaula fàrmac
Línia 1:
{{Infotaula fàrmac}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477374547
| IUPAC_name = (''RS'')-1-Butyl-''N''-(2,6-dimethylphenyl)piperidine-2-carboxamide
| image = Bupivacaine skeletal.svg
| drug_name =
| image2 =
<!-- Clinical data -->
| pronounce = {{IPAc-en|b|juː|ˈ|p|ɪ|v|ə|k|eɪ|n}}
| tradename = Marcaine, Sensorcaine, Vivacaine, others
| Drugs.com = {{drugs.com|monograph|bupivacaine-hydrochloride}}
| pregnancy_AU = A
| legal_AU = S4
| routes_of_administration = [[parenteral]], [[topical]]
<!-- Pharmacokinetic data -->
| bioavailability = n/a
| protein_bound = 95%
| metabolism = [[Liver]]
| onset = Within 15 min<ref name=AHFS2015/>
| duration_of_action= 2 to 8 hr<ref name=Wh1997/>
| elimination_half-life = 3.1 hours (adults)<ref name=AHFS2015/><br />8.1 hours (neonates)<ref name=AHFS2015/>
| excretion = [[Kidney]], 4–10%
<!-- Identifiers -->
| index_label =
| index2_label =
| ATC_prefix = N01
| ATC_suffix = BB01
| PubChem2 = 5282419
| IUPHAR_ligand = 2397
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00297
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Y8335394RO
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07552
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 60789
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1098
| CAS_number = 38396-39-3
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number2_Ref = {{cascite|changed|??}}
| CAS_number2 = 2180-92-9
| PubChem = 2474
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2380
<!-- Chemical data -->
| C=18 | H=28 | N=2 | O=1
| molecular_weight = 288.43 g/mol
| smiles = O=C(C1N(CCCC1)CCCC)NC2=C(C)C=CC=C2C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H28N2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LEBVLXFERQHONN-UHFFFAOYSA-N
| melting_point = 107
| melting_high = 108
}}
<!-- Definition and medical uses -->
La '''Bupivacaïna''', és un medicament usat en l'anestèsia local.<ref name=AHFS2015>{{cite web|title=Bupivacaine Hydrochloride|url=http://www.drugs.com/monograph/bupivacaine-hydrochloride.html|publisher=The American Society of Health-System Pharmacists|accessdate=Aug 1, 2015|deadurl=no|archiveurl=https://web.archive.org/web/20150630101203/http://www.drugs.com/monograph/bupivacaine-hydrochloride.html|archivedate=2015-06-30|df=}}</ref> Es fa servir per injecció dins una zona al voltant d'un nervi o com bloqueig epidural.<ref name=AHFS2015/> Està disponible mesclada amb una petita quantitat d' [[epinefrina]] per a incrementar-ne la durada.<ref name=AHFS2015/> Típicament triga 15 minuts en fer efecte i dura de 2 a 8 hores.<ref name=AHFS2015/><ref name=Wh1997>{{cite book|last1=Whimster|first1=David Skinner|title=Cambridge textbook of accident and emergency medicine|date=1997|publisher=Cambridge University Press|location=Cambridge|isbn=9780521433792|page=194|url=https://books.google.ca/books?id=m0bNaDhkaukC&pg=PA194|deadurl=no|archiveurl=https://web.archive.org/web/20151005030600/https://books.google.ca/books?id=m0bNaDhkaukC&pg=PA194|archivedate=2015-10-05|df=}}</ref>
Obtingut de «https://ca.wikipedia.org/wiki/Bupivacaïna»